C22H38FO6P — CID 11698068
fluoro-[2-methoxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]phosphinic acid (PubChem CID 11698068) has the molecular formula C22H38FO6P and a molecular weight of 448.51 g/mol. Its IUPAC name is fluoro-[2-methoxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]phosphinic acid.
| Compound Name | fluoro-[2-methoxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]phosphinic acid |
|---|---|
| PubChem CID | 11698068 |
| Molecular Formula | C22H38FO6P |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | fluoro-[2-methoxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]phosphinic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)F)OC |
| InChI | InChI=1S/C22H38FO6P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(24)28-19-21(27-2)20-29-30(23,25)26/h4-5,7-8,10-11,21H,3,6,9,12-20H2,1-2H3,(H,25,26)/b5-4-,8-7-,11-10- |
| InChIKey | LUJRKCJIACXZAE-YSTUJMKBSA-N |
| XLogP | 6.22 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|