C39H65O8P — CID 138216352
[1-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-phosphonooxypropan-2-yl] (11Z,14Z,17Z)-icosa-11,14,17-trienoate (PubChem CID 138216352) has the molecular formula C39H65O8P and a molecular weight of 692.92 g/mol. Its IUPAC name is [1-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-phosphonooxypropan-2-yl] (11Z,14Z,17Z)-icosa-11,14,17-trienoate.
| Compound Name | [1-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-phosphonooxypropan-2-yl] (11Z,14Z,17Z)-icosa-11,14,17-trienoate |
|---|---|
| PubChem CID | 138216352 |
| Molecular Formula | C39H65O8P |
| Molecular Weight | 692.92 g/mol |
| Exact Mass | 692.44 |
| IUPAC Name | [1-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-phosphonooxypropan-2-yl] (11Z,14Z,17Z)-icosa-11,14,17-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OC(COC(=O)CCCCC/C=C\C/C=C\C/C=C\CC)COP(=O)(O)O |
| InChI | InChI=1S/C39H65O8P/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-32-34-39(41)47-37(36-46-48(42,43)44)35-45-38(40)33-31-29-27-25-23-21-16-14-12-10-8-6-4-2/h5-8,11-14,17-18,21,23,37H,3-4,9-10,15-16,19-20,22,24-36H2,1-2H3,(H2,42,43,44)/b7-5-,8-6-,13-11-,14-12-,18-17-,23-21- |
| InChIKey | NAAWIWVQRQGZMX-SFOGOALASA-N |
| XLogP | 10.73 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.92 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|