C41H71O8P — CID 134762301
[(2R)-2-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropyl] (11E,14E)-icosa-11,14-dienoate (PubChem CID 134762301) has the molecular formula C41H71O8P and a molecular weight of 722.99 g/mol. Its IUPAC name is [(2R)-2-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropyl] (11E,14E)-icosa-11,14-dienoate.
| Compound Name | [(2R)-2-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropyl] (11E,14E)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 134762301 |
| Molecular Formula | C41H71O8P |
| Molecular Weight | 722.99 g/mol |
| Exact Mass | 722.49 |
| IUPAC Name | [(2R)-2-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropyl] (11E,14E)-icosa-11,14-dienoate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C/C/C=C/CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C41H71O8P/c1-3-5-7-9-11-13-15-17-19-20-22-23-25-27-29-31-33-35-40(42)47-37-39(38-48-50(44,45)46)49-41(43)36-34-32-30-28-26-24-21-18-16-14-12-10-8-6-4-2/h6,8,11-14,17-19,21,39H,3-5,7,9-10,15-16,20,22-38H2,1-2H3,(H2,44,45,46)/b8-6+,13-11+,14-12+,19-17+,21-18+/t39-/m1/s1 |
| InChIKey | QUKUXCRNNYYJEK-TXRWXTRCSA-N |
| XLogP | 11.73 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.99 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|