C34H59O8P — CID 138253191
[1-[(Z)-pentadec-9-enoyl]oxy-3-phosphonooxypropan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate (PubChem CID 138253191) has the molecular formula C34H59O8P and a molecular weight of 626.81 g/mol. Its IUPAC name is [1-[(Z)-pentadec-9-enoyl]oxy-3-phosphonooxypropan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate.
| Compound Name | [1-[(Z)-pentadec-9-enoyl]oxy-3-phosphonooxypropan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
|---|---|
| PubChem CID | 138253191 |
| Molecular Formula | C34H59O8P |
| Molecular Weight | 626.81 g/mol |
| Exact Mass | 626.39 |
| IUPAC Name | [1-[(Z)-pentadec-9-enoyl]oxy-3-phosphonooxypropan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C34H59O8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34(36)42-32(31-41-43(37,38)39)30-40-33(35)28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5,7,11-14,17,19,32H,3-4,6,8-10,15-16,18,20-31H2,1-2H3,(H2,37,38,39)/b7-5-,13-11-,14-12-,19-17- |
| InChIKey | RKODWACDJNJSMX-PSVXZWTGSA-N |
| XLogP | 9.23 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.81 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|