C32H57O8P — CID 134783990
[(2R)-1-phosphonooxy-3-undecanoyloxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate (PubChem CID 134783990) has the molecular formula C32H57O8P and a molecular weight of 600.77 g/mol. Its IUPAC name is [(2R)-1-phosphonooxy-3-undecanoyloxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate.
| Compound Name | [(2R)-1-phosphonooxy-3-undecanoyloxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 134783990 |
| Molecular Formula | C32H57O8P |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | [(2R)-1-phosphonooxy-3-undecanoyloxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C32H57O8P/c1-3-5-7-9-11-13-14-15-16-17-18-19-21-23-25-27-32(34)40-30(29-39-41(35,36)37)28-38-31(33)26-24-22-20-12-10-8-6-4-2/h5,7,11,13,15-16,30H,3-4,6,8-10,12,14,17-29H2,1-2H3,(H2,35,36,37)/b7-5+,13-11+,16-15+/t30-/m1/s1 |
| InChIKey | ZGIWJGHDDFZHFT-GMMMPXINSA-N |
| XLogP | 8.67 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|