C9H8ClN3OS — CID 116982351
4-(5-chlorothiophen-2-yl)-3-methyl-2-oxoimidazolidine-1-carbonitrile (PubChem CID 116982351) has the molecular formula C9H8ClN3OS and a molecular weight of 241.70 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-3-methyl-2-oxoimidazolidine-1-carbonitrile.
| Compound Name | 4-(5-chlorothiophen-2-yl)-3-methyl-2-oxoimidazolidine-1-carbonitrile |
|---|---|
| PubChem CID | 116982351 |
| Molecular Formula | C9H8ClN3OS |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-3-methyl-2-oxoimidazolidine-1-carbonitrile |
| SMILES | CN1C(=O)N(C#N)CC1c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H8ClN3OS/c1-12-6(4-13(5-11)9(12)14)7-2-3-8(10)15-7/h2-3,6H,4H2,1H3 |
| InChIKey | HMHQBERQGGAHSM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|