methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate

C9H16N2O3 — CID 116982599

IUPACmethyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate
SMILESCOC(=O)CCN1CC(C)N(C)C1=O
InChIInChI=1S/C9H16N2O3/c1-7-6-11(9(13)10(7)2)5-4-8(12)14-3/h7H,4-6H2,1-3H3
InChIKeyJPRLFKVEPQRGSJ-UHFFFAOYSA-N
MW200.24 g/mol
LogP0.31
Rot. Bonds3

About methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate

methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate (PubChem CID 116982599) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate
PubChem CID116982599
Molecular FormulaC9H16N2O3
Molecular Weight200.24 g/mol
Exact Mass200.12
IUPAC Namemethyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate
SMILESCOC(=O)CCN1CC(C)N(C)C1=O
InChIInChI=1S/C9H16N2O3/c1-7-6-11(9(13)10(7)2)5-4-8(12)14-3/h7H,4-6H2,1-3H3
InChIKeyJPRLFKVEPQRGSJ-UHFFFAOYSA-N
XLogP0.31
TPSA49.85 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.24
LogP ≤ 50.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate?
The IUPAC name of methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate (CID 116982599) is methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate.
What is the SMILES notation for methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate?
The canonical SMILES for methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate is COC(=O)CCN1CC(C)N(C)C1=O.
What is the InChIKey of methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate?
The InChIKey is JPRLFKVEPQRGSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-7-6-11(9(13)10(7)2)5-4-8(12)14-3/h7H,4-6H2,1-3H3.
What are the key properties of methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate?
methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate has a molecular weight of 200.24 g/mol, XLogP of 0.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,4-dimethyl-2-oxoimidazolidin-1-yl)propanoate is sourced from PubChem (CID 116982599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).