C13H17ClN2O2 — CID 116983020
4-(3-chloro-4-methoxyphenyl)-1-ethyl-3-methylimidazolidin-2-one (PubChem CID 116983020) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 4-(3-chloro-4-methoxyphenyl)-1-ethyl-3-methylimidazolidin-2-one.
| Compound Name | 4-(3-chloro-4-methoxyphenyl)-1-ethyl-3-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 116983020 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-(3-chloro-4-methoxyphenyl)-1-ethyl-3-methylimidazolidin-2-one |
| SMILES | CCN1CC(c2ccc(OC)c(Cl)c2)N(C)C1=O |
| InChI | InChI=1S/C13H17ClN2O2/c1-4-16-8-11(15(2)13(16)17)9-5-6-12(18-3)10(14)7-9/h5-7,11H,4,8H2,1-3H3 |
| InChIKey | HGHKMQVRBNVWBJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |