C8H8N4O2 — CID 116984081
3-hydrazinylimidazo[1,5-a]pyridine-1-carboxylic acid (PubChem CID 116984081) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 3-hydrazinylimidazo[1,5-a]pyridine-1-carboxylic acid.
| Compound Name | 3-hydrazinylimidazo[1,5-a]pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 116984081 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 3-hydrazinylimidazo[1,5-a]pyridine-1-carboxylic acid |
| SMILES | NNc1nc(C(=O)O)c2ccccn12 |
| InChI | InChI=1S/C8H8N4O2/c9-11-8-10-6(7(13)14)5-3-1-2-4-12(5)8/h1-4H,9H2,(H,10,11)(H,13,14) |
| InChIKey | HTKGQFVXMQBDQD-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|