C10H9ClN2O2 — CID 116984026
3-(2-chloroethyl)imidazo[1,5-a]pyridine-1-carboxylic acid (PubChem CID 116984026) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is 3-(2-chloroethyl)imidazo[1,5-a]pyridine-1-carboxylic acid.
| Compound Name | 3-(2-chloroethyl)imidazo[1,5-a]pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 116984026 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 3-(2-chloroethyl)imidazo[1,5-a]pyridine-1-carboxylic acid |
| SMILES | O=C(O)c1nc(CCCl)n2ccccc12 |
| InChI | InChI=1S/C10H9ClN2O2/c11-5-4-8-12-9(10(14)15)7-3-1-2-6-13(7)8/h1-3,6H,4-5H2,(H,14,15) |
| InChIKey | NBXZUKJWVHLPLF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|