C27H38N2O5 — CID 11698487
N-[[(3R,4R)-4-benzylpyrrolidin-3-yl]methyl]-4-methoxy-N-(2-methoxyethyl)-3-(3-methoxypropoxy)benzamide (PubChem CID 11698487) has the molecular formula C27H38N2O5 and a molecular weight of 470.61 g/mol. Its IUPAC name is N-[[(3R,4R)-4-benzylpyrrolidin-3-yl]methyl]-4-methoxy-N-(2-methoxyethyl)-3-(3-methoxypropoxy)benzamide.
| Compound Name | N-[[(3R,4R)-4-benzylpyrrolidin-3-yl]methyl]-4-methoxy-N-(2-methoxyethyl)-3-(3-methoxypropoxy)benzamide |
|---|---|
| PubChem CID | 11698487 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | N-[[(3R,4R)-4-benzylpyrrolidin-3-yl]methyl]-4-methoxy-N-(2-methoxyethyl)-3-(3-methoxypropoxy)benzamide |
| SMILES | COCCCOc1cc(C(=O)N(CCOC)C[C@H]2CNC[C@@H]2Cc2ccccc2)ccc1OC |
| InChI | InChI=1S/C27H38N2O5/c1-31-13-7-14-34-26-17-22(10-11-25(26)33-3)27(30)29(12-15-32-2)20-24-19-28-18-23(24)16-21-8-5-4-6-9-21/h4-6,8-11,17,23-24,28H,7,12-16,18-20H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | JTQDNXSOUPBLKF-BJKOFHAPSA-N |
| XLogP | 3.28 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|