C30H37ClN2O4 — CID 71602060
N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-phenylbenzamide;hydrochloride (PubChem CID 71602060) has the molecular formula C30H37ClN2O4 and a molecular weight of 525.09 g/mol. Its IUPAC name is N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-phenylbenzamide;hydrochloride.
| Compound Name | N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-phenylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 71602060 |
| Molecular Formula | C30H37ClN2O4 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-phenylbenzamide;hydrochloride |
| SMILES | COCCCOc1cc(C(=O)N(C[C@@H]2CNC[C@H]2Cc2ccccc2)c2ccccc2)ccc1OC.Cl |
| InChI | InChI=1S/C30H36N2O4.ClH/c1-34-16-9-17-36-29-19-24(14-15-28(29)35-2)30(33)32(27-12-7-4-8-13-27)22-26-21-31-20-25(26)18-23-10-5-3-6-11-23;/h3-8,10-15,19,25-26,31H,9,16-18,20-22H2,1-2H3;1H/t25-,26+;/m1./s1 |
| InChIKey | DCTKERMJIJLMFH-QGLFPKSOSA-N |
| XLogP | 5.26 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|