C30H37ClN2O3 — CID 11555275
N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]aniline (PubChem CID 11555275) has the molecular formula C30H37ClN2O3 and a molecular weight of 509.09 g/mol. Its IUPAC name is N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]aniline.
| Compound Name | N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 11555275 |
| Molecular Formula | C30H37ClN2O3 |
| Molecular Weight | 509.09 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]aniline |
| SMILES | COCCCOc1cc(CN(C[C@@H]2CNC[C@H]2Cc2ccccc2)c2ccc(Cl)cc2)ccc1OC |
| InChI | InChI=1S/C30H37ClN2O3/c1-34-15-6-16-36-30-18-24(9-14-29(30)35-2)21-33(28-12-10-27(31)11-13-28)22-26-20-32-19-25(26)17-23-7-4-3-5-8-23/h3-5,7-14,18,25-26,32H,6,15-17,19-22H2,1-2H3/t25-,26+/m1/s1 |
| InChIKey | WKIAMHCWMIABDD-FTJBHMTQSA-N |
| XLogP | 5.85 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.09 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|