C16H17N3 — CID 116985837
8-(pyrrolidin-3-ylmethyl)-5H-pyrido[4,3-b]indole (PubChem CID 116985837) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 8-(pyrrolidin-3-ylmethyl)-5H-pyrido[4,3-b]indole.
| Compound Name | 8-(pyrrolidin-3-ylmethyl)-5H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 116985837 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 8-(pyrrolidin-3-ylmethyl)-5H-pyrido[4,3-b]indole |
| SMILES | c1cc2[nH]c3ccc(CC4CCNC4)cc3c2cn1 |
| InChI | InChI=1S/C16H17N3/c1-2-15-13(14-10-18-6-4-16(14)19-15)8-11(1)7-12-3-5-17-9-12/h1-2,4,6,8,10,12,17,19H,3,5,7,9H2 |
| InChIKey | WJVKMVKZJWLMDA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |