C16H18N4 — CID 116985884
8-(4-methylpiperazin-2-yl)-5H-pyrido[4,3-b]indole (PubChem CID 116985884) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 8-(4-methylpiperazin-2-yl)-5H-pyrido[4,3-b]indole.
| Compound Name | 8-(4-methylpiperazin-2-yl)-5H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 116985884 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 8-(4-methylpiperazin-2-yl)-5H-pyrido[4,3-b]indole |
| SMILES | CN1CCNC(c2ccc3[nH]c4ccncc4c3c2)C1 |
| InChI | InChI=1S/C16H18N4/c1-20-7-6-18-16(10-20)11-2-3-14-12(8-11)13-9-17-5-4-15(13)19-14/h2-5,8-9,16,18-19H,6-7,10H2,1H3 |
| InChIKey | VOAVOMMZNYGNOO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |