C14H16O3 — CID 116987382
2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid (PubChem CID 116987382) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid.
| Compound Name | 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid |
|---|---|
| PubChem CID | 116987382 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid |
| SMILES | Cc1oc2ccccc2c1CC(C)(C)C(=O)O |
| InChI | InChI=1S/C14H16O3/c1-9-11(8-14(2,3)13(15)16)10-6-4-5-7-12(10)17-9/h4-7H,8H2,1-3H3,(H,15,16) |
| InChIKey | DAGBCBBAVGIPDW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |