2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid

C14H16O3 — CID 116987382

IUPAC2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid
SMILESCc1oc2ccccc2c1CC(C)(C)C(=O)O
InChIInChI=1S/C14H16O3/c1-9-11(8-14(2,3)13(15)16)10-6-4-5-7-12(10)17-9/h4-7H,8H2,1-3H3,(H,15,16)
InChIKeyDAGBCBBAVGIPDW-UHFFFAOYSA-N
MW232.28 g/mol
LogP3.39
Rot. Bonds3

About 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid

2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid (PubChem CID 116987382) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid.

Molecular Properties

Compound Name2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid
PubChem CID116987382
Molecular FormulaC14H16O3
Molecular Weight232.28 g/mol
Exact Mass232.11
IUPAC Name2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid
SMILESCc1oc2ccccc2c1CC(C)(C)C(=O)O
InChIInChI=1S/C14H16O3/c1-9-11(8-14(2,3)13(15)16)10-6-4-5-7-12(10)17-9/h4-7H,8H2,1-3H3,(H,15,16)
InChIKeyDAGBCBBAVGIPDW-UHFFFAOYSA-N
XLogP3.39
TPSA50.44 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.28
LogP ≤ 53.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid?
The IUPAC name of 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid (CID 116987382) is 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid.
What is the SMILES notation for 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid?
The canonical SMILES for 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid is Cc1oc2ccccc2c1CC(C)(C)C(=O)O.
What is the InChIKey of 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid?
The InChIKey is DAGBCBBAVGIPDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O3/c1-9-11(8-14(2,3)13(15)16)10-6-4-5-7-12(10)17-9/h4-7H,8H2,1-3H3,(H,15,16).
What are the key properties of 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid?
2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid has a molecular weight of 232.28 g/mol, XLogP of 3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-(2-methyl-1-benzofuran-3-yl)propanoic acid is sourced from PubChem (CID 116987382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).