2-(2-methyl-1-benzofuran-3-yl)acetyl chloride

C11H9ClO2 — CID 142975043

IUPAC2-(2-methyl-1-benzofuran-3-yl)acetyl chloride
SMILESCc1oc2ccccc2c1CC(=O)Cl
InChIInChI=1S/C11H9ClO2/c1-7-9(6-11(12)13)8-4-2-3-5-10(8)14-7/h2-5H,6H2,1H3
InChIKeyJXPVOGPMGIXJLT-UHFFFAOYSA-N
MW208.64 g/mol
LogP3.05
Rot. Bonds2

About 2-(2-methyl-1-benzofuran-3-yl)acetyl chloride

2-(2-methyl-1-benzofuran-3-yl)acetyl chloride (PubChem CID 142975043) has the molecular formula C11H9ClO2 and a molecular weight of 208.64 g/mol. Its IUPAC name is 2-(2-methyl-1-benzofuran-3-yl)acetyl chloride.

Molecular Properties

Compound Name2-(2-methyl-1-benzofuran-3-yl)acetyl chloride
PubChem CID142975043
Molecular FormulaC11H9ClO2
Molecular Weight208.64 g/mol
Exact Mass208.03
IUPAC Name2-(2-methyl-1-benzofuran-3-yl)acetyl chloride
SMILESCc1oc2ccccc2c1CC(=O)Cl
InChIInChI=1S/C11H9ClO2/c1-7-9(6-11(12)13)8-4-2-3-5-10(8)14-7/h2-5H,6H2,1H3
InChIKeyJXPVOGPMGIXJLT-UHFFFAOYSA-N
XLogP3.05
TPSA30.21 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.64
LogP ≤ 53.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(2-methyl-1-benzofuran-3-yl)acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-methyl-1-benzofuran-3-yl)acetyl chloride?
The IUPAC name of 2-(2-methyl-1-benzofuran-3-yl)acetyl chloride (CID 142975043) is 2-(2-methyl-1-benzofuran-3-yl)acetyl chloride.
What is the SMILES notation for 2-(2-methyl-1-benzofuran-3-yl)acetyl chloride?
The canonical SMILES for 2-(2-methyl-1-benzofuran-3-yl)acetyl chloride is Cc1oc2ccccc2c1CC(=O)Cl.
What is the InChIKey of 2-(2-methyl-1-benzofuran-3-yl)acetyl chloride?
The InChIKey is JXPVOGPMGIXJLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClO2/c1-7-9(6-11(12)13)8-4-2-3-5-10(8)14-7/h2-5H,6H2,1H3.
What are the key properties of 2-(2-methyl-1-benzofuran-3-yl)acetyl chloride?
2-(2-methyl-1-benzofuran-3-yl)acetyl chloride has a molecular weight of 208.64 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1-benzofuran-3-yl)acetyl chloride is sourced from PubChem (CID 142975043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).