C21H21N3OS — CID 1169875
1-(3,4-dihydro-2H-quinolin-1-yl)-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylethanone (PubChem CID 1169875) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylethanone.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 1169875 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylethanone |
| SMILES | Cn1c(-c2ccccc2)cnc1SCC(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C21H21N3OS/c1-23-19(17-8-3-2-4-9-17)14-22-21(23)26-15-20(25)24-13-7-11-16-10-5-6-12-18(16)24/h2-6,8-10,12,14H,7,11,13,15H2,1H3 |
| InChIKey | WBBVMMSAGSJBTM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|