C26H34F6O3 — CID 11699104
trans-(1R,3S,5Z)-4-methylidene-5-[(E)-3-[(1S,3R)-2,2,3-trimethyl-3-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)hept-4-yn-2-yl]cyclopentyl]prop-2-enylidene]cyclohexane-1,3-diol (PubChem CID 11699104) has the molecular formula C26H34F6O3 and a molecular weight of 508.54 g/mol. Its IUPAC name is trans-(1R,3S,5Z)-4-methylidene-5-[(E)-3-[(1S,3R)-2,2,3-trimethyl-3-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)hept-4-yn-2-yl]cyclopentyl]prop-2-enylidene]cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S,5Z)-4-methylidene-5-[(E)-3-[(1S,3R)-2,2,3-trimethyl-3-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)hept-4-yn-2-yl]cyclopentyl]prop-2-enylidene]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 11699104 |
| Molecular Formula | C26H34F6O3 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | trans-(1R,3S,5Z)-4-methylidene-5-[(E)-3-[(1S,3R)-2,2,3-trimethyl-3-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)hept-4-yn-2-yl]cyclopentyl]prop-2-enylidene]cyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C\[C@@H]2CC[C@](C)([C@H](C)CC#CC(O)(C(F)(F)F)C(F)(F)F)C2(C)C)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H34F6O3/c1-16(8-7-12-24(35,25(27,28)29)26(30,31)32)23(5)13-11-19(22(23,3)4)10-6-9-18-14-20(33)15-21(34)17(18)2/h6,9-10,16,19-21,33-35H,2,8,11,13-15H2,1,3-5H3/b10-6+,18-9-/t16-,19-,20-,21+,23-/m1/s1 |
| InChIKey | FKAANNCGMJCBNF-VQYWLEADSA-N |
| XLogP | 5.87 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|