C25H44O3 — CID 87505239
trans-(1R,3R)-5-[(E)-3-[(1S)-3-[(2S,5R)-5-hydroxy-6-methylheptan-2-yl]-2,2,3-trimethylcyclopentyl]prop-2-enylidene]cyclohexane-1,3-diol (PubChem CID 87505239) has the molecular formula C25H44O3 and a molecular weight of 392.62 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(E)-3-[(1S)-3-[(2S,5R)-5-hydroxy-6-methylheptan-2-yl]-2,2,3-trimethylcyclopentyl]prop-2-enylidene]cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(E)-3-[(1S)-3-[(2S,5R)-5-hydroxy-6-methylheptan-2-yl]-2,2,3-trimethylcyclopentyl]prop-2-enylidene]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 87505239 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | trans-(1R,3R)-5-[(E)-3-[(1S)-3-[(2S,5R)-5-hydroxy-6-methylheptan-2-yl]-2,2,3-trimethylcyclopentyl]prop-2-enylidene]cyclohexane-1,3-diol |
| SMILES | CC(C)[C@H](O)CC[C@H](C)C1(C)CC[C@@H](/C=C/C=C2C[C@@H](O)C[C@H](O)C2)C1(C)C |
| InChI | InChI=1S/C25H44O3/c1-17(2)23(28)11-10-18(3)25(6)13-12-20(24(25,4)5)9-7-8-19-14-21(26)16-22(27)15-19/h7-9,17-18,20-23,26-28H,10-16H2,1-6H3/b9-7+/t18-,20+,21+,22+,23+,25?/m0/s1 |
| InChIKey | ZMRFJTAXNKQYAY-NASWMFPRSA-N |
| XLogP | 5.25 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |