C27H46O3 — CID 22797544
(1S,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,3-diol (PubChem CID 22797544) has the molecular formula C27H46O3 and a molecular weight of 418.66 g/mol. Its IUPAC name is (1S,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,3-diol.
| Compound Name | (1S,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
|---|---|
| PubChem CID | 22797544 |
| Molecular Formula | C27H46O3 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | (1S,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
| SMILES | CC(C)C(O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(O)C[C@H](O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H46O3/c1-16(2)24(29)11-6-17(3)21-9-10-22-20-8-7-18-14-19(28)15-25(30)27(18,5)23(20)12-13-26(21,22)4/h7,16-17,19-25,28-30H,6,8-15H2,1-5H3/t17-,19?,20+,21-,22+,23+,24?,25+,26-,27+/m1/s1 |
| InChIKey | CXRFZFYBGWQFGK-HEXHXOQMSA-N |
| XLogP | 5.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|