C24H38O4 — CID 57178072
methyl 3-[(8S,9S,10R,13R,14S,17R)-1,3-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 57178072) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is methyl 3-[(8S,9S,10R,13R,14S,17R)-1,3-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | methyl 3-[(8S,9S,10R,13R,14S,17R)-1,3-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 57178072 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | methyl 3-[(8S,9S,10R,13R,14S,17R)-1,3-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | COC(=O)CC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(O)CC(O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H38O4/c1-14(11-22(27)28-4)18-7-8-19-17-6-5-15-12-16(25)13-21(26)24(15,3)20(17)9-10-23(18,19)2/h5,14,16-21,25-26H,6-13H2,1-4H3/t14?,16?,17-,18+,19-,20-,21?,23+,24-/m0/s1 |
| InChIKey | MUVDVGOMAHICEO-YXZXCFHJSA-N |
| XLogP | 4.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|