C26H44O4 — CID 70570557
(8S,9S,10R,13S,14S,17R)-17-[(2S)-1-(1-ethoxyethoxy)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,3-diol (PubChem CID 70570557) has the molecular formula C26H44O4 and a molecular weight of 420.63 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-17-[(2S)-1-(1-ethoxyethoxy)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,3-diol.
| Compound Name | (8S,9S,10R,13S,14S,17R)-17-[(2S)-1-(1-ethoxyethoxy)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
|---|---|
| PubChem CID | 70570557 |
| Molecular Formula | C26H44O4 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-17-[(2S)-1-(1-ethoxyethoxy)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
| SMILES | CCOC(C)OC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(O)CC(O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H44O4/c1-6-29-17(3)30-15-16(2)21-9-10-22-20-8-7-18-13-19(27)14-24(28)26(18,5)23(20)11-12-25(21,22)4/h7,16-17,19-24,27-28H,6,8-15H2,1-5H3/t16-,17?,19?,20+,21-,22+,23+,24?,25-,26+/m1/s1 |
| InChIKey | JHXMXFQSEBJNOS-IWVHXFQPSA-N |
| XLogP | 4.93 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|