C10H16F2N2O — CID 116991691
1-(3,3-difluoropyrrolidin-1-yl)-2-pyrrolidin-3-ylethanone (PubChem CID 116991691) has the molecular formula C10H16F2N2O and a molecular weight of 218.25 g/mol. Its IUPAC name is 1-(3,3-difluoropyrrolidin-1-yl)-2-pyrrolidin-3-ylethanone.
| Compound Name | 1-(3,3-difluoropyrrolidin-1-yl)-2-pyrrolidin-3-ylethanone |
|---|---|
| PubChem CID | 116991691 |
| Molecular Formula | C10H16F2N2O |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-(3,3-difluoropyrrolidin-1-yl)-2-pyrrolidin-3-ylethanone |
| SMILES | O=C(CC1CCNC1)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C10H16F2N2O/c11-10(12)2-4-14(7-10)9(15)5-8-1-3-13-6-8/h8,13H,1-7H2 |
| InChIKey | OETFDTZJZQSBPS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |