C10H18F2N2 — CID 130630857
(3R)-3-[(3,3-difluoropyrrolidin-1-yl)methyl]piperidine (PubChem CID 130630857) has the molecular formula C10H18F2N2 and a molecular weight of 204.26 g/mol. Its IUPAC name is (3R)-3-[(3,3-difluoropyrrolidin-1-yl)methyl]piperidine.
| Compound Name | (3R)-3-[(3,3-difluoropyrrolidin-1-yl)methyl]piperidine |
|---|---|
| PubChem CID | 130630857 |
| Molecular Formula | C10H18F2N2 |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (3R)-3-[(3,3-difluoropyrrolidin-1-yl)methyl]piperidine |
| SMILES | FC1(F)CCN(C[C@@H]2CCCNC2)C1 |
| InChI | InChI=1S/C10H18F2N2/c11-10(12)3-5-14(8-10)7-9-2-1-4-13-6-9/h9,13H,1-8H2/t9-/m1/s1 |
| InChIKey | IBSNPTYRXNSPFP-SECBINFHSA-N |
| XLogP | 1.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |