C12H24ClN3O — CID 120849955
3-methyl-1-(piperidin-3-ylmethyl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 120849955) has the molecular formula C12H24ClN3O and a molecular weight of 261.80 g/mol. Its IUPAC name is 3-methyl-1-(piperidin-3-ylmethyl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | 3-methyl-1-(piperidin-3-ylmethyl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120849955 |
| Molecular Formula | C12H24ClN3O |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 3-methyl-1-(piperidin-3-ylmethyl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | CC1(C(N)=O)CCN(CC2CCCNC2)C1.Cl |
| InChI | InChI=1S/C12H23N3O.ClH/c1-12(11(13)16)4-6-15(9-12)8-10-3-2-5-14-7-10;/h10,14H,2-9H2,1H3,(H2,13,16);1H |
| InChIKey | CJHWNSMTIYHVLD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |