C24H26N2O2S — CID 1169929
3-benzyl-1-[(3,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)thiourea (PubChem CID 1169929) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 3-benzyl-1-[(3,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)thiourea.
| Compound Name | 3-benzyl-1-[(3,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 1169929 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 3-benzyl-1-[(3,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)thiourea |
| SMILES | COc1ccc(CN(C(=S)NCc2ccccc2)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C24H26N2O2S/c1-18-9-12-21(13-10-18)26(24(29)25-16-19-7-5-4-6-8-19)17-20-11-14-22(27-2)23(15-20)28-3/h4-15H,16-17H2,1-3H3,(H,25,29) |
| InChIKey | LGCAWQCLYIJPTM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|