C14H18N2OS — CID 116994439
4-methyl-7-piperidin-2-yl-1,4-benzothiazin-3-one (PubChem CID 116994439) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 4-methyl-7-piperidin-2-yl-1,4-benzothiazin-3-one.
| Compound Name | 4-methyl-7-piperidin-2-yl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116994439 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-methyl-7-piperidin-2-yl-1,4-benzothiazin-3-one |
| SMILES | CN1C(=O)CSc2cc(C3CCCCN3)ccc21 |
| InChI | InChI=1S/C14H18N2OS/c1-16-12-6-5-10(11-4-2-3-7-15-11)8-13(12)18-9-14(16)17/h5-6,8,11,15H,2-4,7,9H2,1H3 |
| InChIKey | LXQJHAZTQOBEEO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |