C14H18N2O — CID 82288921
1-methyl-6-pyrrolidin-2-yl-3,4-dihydroquinolin-2-one (PubChem CID 82288921) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-methyl-6-pyrrolidin-2-yl-3,4-dihydroquinolin-2-one.
| Compound Name | 1-methyl-6-pyrrolidin-2-yl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 82288921 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-methyl-6-pyrrolidin-2-yl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(C3CCCN3)ccc21 |
| InChI | InChI=1S/C14H18N2O/c1-16-13-6-4-10(12-3-2-8-15-12)9-11(13)5-7-14(16)17/h4,6,9,12,15H,2-3,5,7-8H2,1H3 |
| InChIKey | NNPQJLHMEOHNFO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |