C10H6N2OS — CID 117000867
6-thiophen-2-yl-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 117000867) has the molecular formula C10H6N2OS and a molecular weight of 202.24 g/mol. Its IUPAC name is 6-thiophen-2-yl-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 6-thiophen-2-yl-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117000867 |
| Molecular Formula | C10H6N2OS |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 6-thiophen-2-yl-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | c1csc(-c2cnc3ncoc3c2)c1 |
| InChI | InChI=1S/C10H6N2OS/c1-2-9(14-3-1)7-4-8-10(11-5-7)12-6-13-8/h1-6H |
| InChIKey | CIQGUMXUYOOLQY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |