C12H12ClNO4 — CID 117002175
2-[3-(3-chlorophenyl)-2-oxo-1,3-oxazinan-5-yl]acetic acid (PubChem CID 117002175) has the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. Its IUPAC name is 2-[3-(3-chlorophenyl)-2-oxo-1,3-oxazinan-5-yl]acetic acid.
| Compound Name | 2-[3-(3-chlorophenyl)-2-oxo-1,3-oxazinan-5-yl]acetic acid |
|---|---|
| PubChem CID | 117002175 |
| Molecular Formula | C12H12ClNO4 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2-[3-(3-chlorophenyl)-2-oxo-1,3-oxazinan-5-yl]acetic acid |
| SMILES | O=C(O)CC1COC(=O)N(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C12H12ClNO4/c13-9-2-1-3-10(5-9)14-6-8(4-11(15)16)7-18-12(14)17/h1-3,5,8H,4,6-7H2,(H,15,16) |
| InChIKey | ULGWHDCOOIIJIB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |