3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid

C15H21NO2 — CID 117002593

IUPAC3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid
SMILESCc1cccc(N2CCC(CCC(=O)O)C2)c1C
InChIInChI=1S/C15H21NO2/c1-11-4-3-5-14(12(11)2)16-9-8-13(10-16)6-7-15(17)18/h3-5,13H,6-10H2,1-2H3,(H,17,18)
InChIKeyPIEJKMMEPFHJLI-UHFFFAOYSA-N
MW247.34 g/mol
LogP2.99
Rot. Bonds4

About 3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid

3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid (PubChem CID 117002593) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid.

Molecular Properties

Compound Name3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid
PubChem CID117002593
Molecular FormulaC15H21NO2
Molecular Weight247.34 g/mol
Exact Mass247.16
IUPAC Name3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid
SMILESCc1cccc(N2CCC(CCC(=O)O)C2)c1C
InChIInChI=1S/C15H21NO2/c1-11-4-3-5-14(12(11)2)16-9-8-13(10-16)6-7-15(17)18/h3-5,13H,6-10H2,1-2H3,(H,17,18)
InChIKeyPIEJKMMEPFHJLI-UHFFFAOYSA-N
XLogP2.99
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.34
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid?
The IUPAC name of 3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid (CID 117002593) is 3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid.
What is the SMILES notation for 3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid?
The canonical SMILES for 3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid is Cc1cccc(N2CCC(CCC(=O)O)C2)c1C.
What is the InChIKey of 3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid?
The InChIKey is PIEJKMMEPFHJLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-11-4-3-5-14(12(11)2)16-9-8-13(10-16)6-7-15(17)18/h3-5,13H,6-10H2,1-2H3,(H,17,18).
What are the key properties of 3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid?
3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid has a molecular weight of 247.34 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,3-dimethylphenyl)pyrrolidin-3-yl]propanoic acid is sourced from PubChem (CID 117002593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).