3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid

C16H23NO2 — CID 117002672

IUPAC3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid
SMILESCc1ccc(N2CCCC(CCC(=O)O)C2)c(C)c1
InChIInChI=1S/C16H23NO2/c1-12-5-7-15(13(2)10-12)17-9-3-4-14(11-17)6-8-16(18)19/h5,7,10,14H,3-4,6,8-9,11H2,1-2H3,(H,18,19)
InChIKeyFWWURPZTICTVHJ-UHFFFAOYSA-N
MW261.37 g/mol
LogP3.38
Rot. Bonds4

About 3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid

3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid (PubChem CID 117002672) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid.

Molecular Properties

Compound Name3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid
PubChem CID117002672
Molecular FormulaC16H23NO2
Molecular Weight261.37 g/mol
Exact Mass261.17
IUPAC Name3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid
SMILESCc1ccc(N2CCCC(CCC(=O)O)C2)c(C)c1
InChIInChI=1S/C16H23NO2/c1-12-5-7-15(13(2)10-12)17-9-3-4-14(11-17)6-8-16(18)19/h5,7,10,14H,3-4,6,8-9,11H2,1-2H3,(H,18,19)
InChIKeyFWWURPZTICTVHJ-UHFFFAOYSA-N
XLogP3.38
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.37
LogP ≤ 53.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid?
The IUPAC name of 3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid (CID 117002672) is 3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid.
What is the SMILES notation for 3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid?
The canonical SMILES for 3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid is Cc1ccc(N2CCCC(CCC(=O)O)C2)c(C)c1.
What is the InChIKey of 3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid?
The InChIKey is FWWURPZTICTVHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-12-5-7-15(13(2)10-12)17-9-3-4-14(11-17)6-8-16(18)19/h5,7,10,14H,3-4,6,8-9,11H2,1-2H3,(H,18,19).
What are the key properties of 3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid?
3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid has a molecular weight of 261.37 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,4-dimethylphenyl)piperidin-3-yl]propanoic acid is sourced from PubChem (CID 117002672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).