C14H17N3O2 — CID 117002769
2-(4-methylphenyl)-1,4,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-3,6-dione (PubChem CID 117002769) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,4,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-3,6-dione.
| Compound Name | 2-(4-methylphenyl)-1,4,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-3,6-dione |
|---|---|
| PubChem CID | 117002769 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-(4-methylphenyl)-1,4,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-3,6-dione |
| SMILES | Cc1ccc(N2CC3CNCC(=O)N3CC2=O)cc1 |
| InChI | InChI=1S/C14H17N3O2/c1-10-2-4-11(5-3-10)16-8-12-6-15-7-13(18)17(12)9-14(16)19/h2-5,12,15H,6-9H2,1H3 |
| InChIKey | IEZDFAQKZSKALO-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |