C17H18N4O3 — CID 96576291
5-[(2S)-2-methyl-4-(4-methylphenyl)-5-oxopiperazine-1-carbonyl]-1H-pyrimidin-6-one (PubChem CID 96576291) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-[(2S)-2-methyl-4-(4-methylphenyl)-5-oxopiperazine-1-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 5-[(2S)-2-methyl-4-(4-methylphenyl)-5-oxopiperazine-1-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 96576291 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 5-[(2S)-2-methyl-4-(4-methylphenyl)-5-oxopiperazine-1-carbonyl]-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(N2C[C@H](C)N(C(=O)c3cnc[nH]c3=O)CC2=O)cc1 |
| InChI | InChI=1S/C17H18N4O3/c1-11-3-5-13(6-4-11)21-8-12(2)20(9-15(21)22)17(24)14-7-18-10-19-16(14)23/h3-7,10,12H,8-9H2,1-2H3,(H,18,19,23)/t12-/m0/s1 |
| InChIKey | PNUIUGQEZOSPSY-LBPRGKRZSA-N |
| XLogP | 0.96 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |