C20H21FN2O3 — CID 97041649
(5S)-4-(2-fluoro-6-methoxybenzoyl)-5-methyl-1-(4-methylphenyl)piperazin-2-one (PubChem CID 97041649) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is (5S)-4-(2-fluoro-6-methoxybenzoyl)-5-methyl-1-(4-methylphenyl)piperazin-2-one.
| Compound Name | (5S)-4-(2-fluoro-6-methoxybenzoyl)-5-methyl-1-(4-methylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 97041649 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (5S)-4-(2-fluoro-6-methoxybenzoyl)-5-methyl-1-(4-methylphenyl)piperazin-2-one |
| SMILES | COc1cccc(F)c1C(=O)N1CC(=O)N(c2ccc(C)cc2)C[C@@H]1C |
| InChI | InChI=1S/C20H21FN2O3/c1-13-7-9-15(10-8-13)23-11-14(2)22(12-18(23)24)20(25)19-16(21)5-4-6-17(19)26-3/h4-10,14H,11-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | RXZDAPJLLWRZON-AWEZNQCLSA-N |
| XLogP | 3.02 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |