C20H22N2O4 — CID 96579782
(5S)-4-(2-hydroxy-3-methoxybenzoyl)-5-methyl-1-(3-methylphenyl)piperazin-2-one (PubChem CID 96579782) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (5S)-4-(2-hydroxy-3-methoxybenzoyl)-5-methyl-1-(3-methylphenyl)piperazin-2-one.
| Compound Name | (5S)-4-(2-hydroxy-3-methoxybenzoyl)-5-methyl-1-(3-methylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 96579782 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (5S)-4-(2-hydroxy-3-methoxybenzoyl)-5-methyl-1-(3-methylphenyl)piperazin-2-one |
| SMILES | COc1cccc(C(=O)N2CC(=O)N(c3cccc(C)c3)C[C@@H]2C)c1O |
| InChI | InChI=1S/C20H22N2O4/c1-13-6-4-7-15(10-13)22-11-14(2)21(12-18(22)23)20(25)16-8-5-9-17(26-3)19(16)24/h4-10,14,24H,11-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | STRZTAIHEJBWPM-AWEZNQCLSA-N |
| XLogP | 2.59 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |