C11H17NO2 — CID 117003144
1-cyclopentyl-3,6-dihydro-2H-pyridine-4-carboxylic acid (PubChem CID 117003144) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-cyclopentyl-3,6-dihydro-2H-pyridine-4-carboxylic acid.
| Compound Name | 1-cyclopentyl-3,6-dihydro-2H-pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 117003144 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 1-cyclopentyl-3,6-dihydro-2H-pyridine-4-carboxylic acid |
| SMILES | O=C(O)C1=CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C11H17NO2/c13-11(14)9-5-7-12(8-6-9)10-3-1-2-4-10/h5,10H,1-4,6-8H2,(H,13,14) |
| InChIKey | DUBLLKGLPNHNSK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |