C14H14N2O2 — CID 117003303
methyl 2-(4-cyano-3,6-dihydro-2H-pyridin-1-yl)benzoate (PubChem CID 117003303) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is methyl 2-(4-cyano-3,6-dihydro-2H-pyridin-1-yl)benzoate.
| Compound Name | methyl 2-(4-cyano-3,6-dihydro-2H-pyridin-1-yl)benzoate |
|---|---|
| PubChem CID | 117003303 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | methyl 2-(4-cyano-3,6-dihydro-2H-pyridin-1-yl)benzoate |
| SMILES | COC(=O)c1ccccc1N1CC=C(C#N)CC1 |
| InChI | InChI=1S/C14H14N2O2/c1-18-14(17)12-4-2-3-5-13(12)16-8-6-11(10-15)7-9-16/h2-6H,7-9H2,1H3 |
| InChIKey | POSVDOIILXIRIV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |