C13H14Cl2N2 — CID 117003663
2-[1-(2,4-dichlorophenyl)piperidin-4-yl]acetonitrile (PubChem CID 117003663) has the molecular formula C13H14Cl2N2 and a molecular weight of 269.17 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)piperidin-4-yl]acetonitrile.
| Compound Name | 2-[1-(2,4-dichlorophenyl)piperidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 117003663 |
| Molecular Formula | C13H14Cl2N2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)piperidin-4-yl]acetonitrile |
| SMILES | N#CCC1CCN(c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C13H14Cl2N2/c14-11-1-2-13(12(15)9-11)17-7-4-10(3-6-16)5-8-17/h1-2,9-10H,3-5,7-8H2 |
| InChIKey | KKVWOLGSJYEDTP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |