C14H16ClFN2 — CID 117044806
2-[1-[(5-chloro-2-fluorophenyl)methyl]piperidin-4-yl]acetonitrile (PubChem CID 117044806) has the molecular formula C14H16ClFN2 and a molecular weight of 266.75 g/mol. Its IUPAC name is 2-[1-[(5-chloro-2-fluorophenyl)methyl]piperidin-4-yl]acetonitrile.
| Compound Name | 2-[1-[(5-chloro-2-fluorophenyl)methyl]piperidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 117044806 |
| Molecular Formula | C14H16ClFN2 |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-[1-[(5-chloro-2-fluorophenyl)methyl]piperidin-4-yl]acetonitrile |
| SMILES | N#CCC1CCN(Cc2cc(Cl)ccc2F)CC1 |
| InChI | InChI=1S/C14H16ClFN2/c15-13-1-2-14(16)12(9-13)10-18-7-4-11(3-6-17)5-8-18/h1-2,9,11H,3-5,7-8,10H2 |
| InChIKey | JMLXQUOJCRXFAY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |