C10H21N3O2 — CID 117004168
2-[[1-[2-(dimethylamino)ethyl]pyrrolidin-3-yl]amino]acetic acid (PubChem CID 117004168) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-[[1-[2-(dimethylamino)ethyl]pyrrolidin-3-yl]amino]acetic acid.
| Compound Name | 2-[[1-[2-(dimethylamino)ethyl]pyrrolidin-3-yl]amino]acetic acid |
|---|---|
| PubChem CID | 117004168 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 2-[[1-[2-(dimethylamino)ethyl]pyrrolidin-3-yl]amino]acetic acid |
| SMILES | CN(C)CCN1CCC(NCC(=O)O)C1 |
| InChI | InChI=1S/C10H21N3O2/c1-12(2)5-6-13-4-3-9(8-13)11-7-10(14)15/h9,11H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | VXBKXFBQRJSVHZ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |