C16H32N4O2 — CID 110895987
N-[1-[2-(dimethylamino)ethyl]piperidin-4-yl]-4-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 110895987) has the molecular formula C16H32N4O2 and a molecular weight of 312.46 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethyl]piperidin-4-yl]-4-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | N-[1-[2-(dimethylamino)ethyl]piperidin-4-yl]-4-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 110895987 |
| Molecular Formula | C16H32N4O2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethyl]piperidin-4-yl]-4-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | CN(C)CCN1CCC(NC(=O)N2CCC(CO)CC2)CC1 |
| InChI | InChI=1S/C16H32N4O2/c1-18(2)11-12-19-7-5-15(6-8-19)17-16(22)20-9-3-14(13-21)4-10-20/h14-15,21H,3-13H2,1-2H3,(H,17,22) |
| InChIKey | UOOAWZLWSSXGIM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |