C14H28N4O — CID 79160685
N-[1-(2-aminoethyl)piperidin-4-yl]-4-methylpiperidine-1-carboxamide (PubChem CID 79160685) has the molecular formula C14H28N4O and a molecular weight of 268.40 g/mol. Its IUPAC name is N-[1-(2-aminoethyl)piperidin-4-yl]-4-methylpiperidine-1-carboxamide.
| Compound Name | N-[1-(2-aminoethyl)piperidin-4-yl]-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 79160685 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | N-[1-(2-aminoethyl)piperidin-4-yl]-4-methylpiperidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)NC2CCN(CCN)CC2)CC1 |
| InChI | InChI=1S/C14H28N4O/c1-12-2-9-18(10-3-12)14(19)16-13-4-7-17(8-5-13)11-6-15/h12-13H,2-11,15H2,1H3,(H,16,19) |
| InChIKey | JTSPPTMTOPUEPG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |