C8H17N3O — CID 23450282
N-[1-(2-aminoethyl)pyrrolidin-3-yl]acetamide (PubChem CID 23450282) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is N-[1-(2-aminoethyl)pyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-(2-aminoethyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 23450282 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | N-[1-(2-aminoethyl)pyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCN(CCN)C1 |
| InChI | InChI=1S/C8H17N3O/c1-7(12)10-8-2-4-11(6-8)5-3-9/h8H,2-6,9H2,1H3,(H,10,12) |
| InChIKey | NKNKAXVZBNGAAZ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |