About N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide
N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide (PubChem CID 144757888) has the molecular formula C13H27N3O
and a molecular weight of 241.38 g/mol. Its IUPAC name is N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide |
| PubChem CID | 144757888 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCN(CC(C)(C)CCN)CC1 |
| InChI | InChI=1S/C13H27N3O/c1-11(17)15-12-4-8-16(9-5-12)10-13(2,3)6-7-14/h12H,4-10,14H2,1-3H3,(H,15,17) |
| InChIKey | IZENSQIOJHJFMW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide?
The IUPAC name of N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide (CID 144757888) is N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide.
What is the SMILES notation for N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide?
The canonical SMILES for N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide is CC(=O)NC1CCN(CC(C)(C)CCN)CC1.
What is the InChIKey of N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide?
The InChIKey is IZENSQIOJHJFMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O/c1-11(17)15-12-4-8-16(9-5-12)10-13(2,3)6-7-14/h12H,4-10,14H2,1-3H3,(H,15,17).
What are the key properties of N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide?
N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide has a molecular weight of 241.38 g/mol, XLogP of 0.96, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-amino-2,2-dimethylbutyl)piperidin-4-yl]acetamide is sourced from PubChem (CID 144757888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).