C14H20N2O2 — CID 117004183
2-[[1-(3,5-dimethylphenyl)pyrrolidin-3-yl]amino]acetic acid (PubChem CID 117004183) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-[[1-(3,5-dimethylphenyl)pyrrolidin-3-yl]amino]acetic acid.
| Compound Name | 2-[[1-(3,5-dimethylphenyl)pyrrolidin-3-yl]amino]acetic acid |
|---|---|
| PubChem CID | 117004183 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-[[1-(3,5-dimethylphenyl)pyrrolidin-3-yl]amino]acetic acid |
| SMILES | Cc1cc(C)cc(N2CCC(NCC(=O)O)C2)c1 |
| InChI | InChI=1S/C14H20N2O2/c1-10-5-11(2)7-13(6-10)16-4-3-12(9-16)15-8-14(17)18/h5-7,12,15H,3-4,8-9H2,1-2H3,(H,17,18) |
| InChIKey | MKAMUZWHKMCAJY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |