C12H15BrN2O — CID 117005401
4-(2-bromophenyl)-1-methyl-1,4-diazepan-2-one (PubChem CID 117005401) has the molecular formula C12H15BrN2O and a molecular weight of 283.17 g/mol. Its IUPAC name is 4-(2-bromophenyl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(2-bromophenyl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 117005401 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4-(2-bromophenyl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(c2ccccc2Br)CC1=O |
| InChI | InChI=1S/C12H15BrN2O/c1-14-7-4-8-15(9-12(14)16)11-6-3-2-5-10(11)13/h2-3,5-6H,4,7-9H2,1H3 |
| InChIKey | ZVRJSMLNMHBBOX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |