C15H22FN3 — CID 117006052
[1-[1-(3-fluorophenyl)pyrrolidin-3-yl]pyrrolidin-3-yl]methanamine (PubChem CID 117006052) has the molecular formula C15H22FN3 and a molecular weight of 263.36 g/mol. Its IUPAC name is [1-[1-(3-fluorophenyl)pyrrolidin-3-yl]pyrrolidin-3-yl]methanamine.
| Compound Name | [1-[1-(3-fluorophenyl)pyrrolidin-3-yl]pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 117006052 |
| Molecular Formula | C15H22FN3 |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | [1-[1-(3-fluorophenyl)pyrrolidin-3-yl]pyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(C2CCN(c3cccc(F)c3)C2)C1 |
| InChI | InChI=1S/C15H22FN3/c16-13-2-1-3-14(8-13)19-7-5-15(11-19)18-6-4-12(9-17)10-18/h1-3,8,12,15H,4-7,9-11,17H2 |
| InChIKey | GUAAZCDXRHZHRJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |