C12H18N2S — CID 24703960
[1-(3-methylsulfanylphenyl)pyrrolidin-3-yl]methanamine (PubChem CID 24703960) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is [1-(3-methylsulfanylphenyl)pyrrolidin-3-yl]methanamine.
| Compound Name | [1-(3-methylsulfanylphenyl)pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 24703960 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | [1-(3-methylsulfanylphenyl)pyrrolidin-3-yl]methanamine |
| SMILES | CSc1cccc(N2CCC(CN)C2)c1 |
| InChI | InChI=1S/C12H18N2S/c1-15-12-4-2-3-11(7-12)14-6-5-10(8-13)9-14/h2-4,7,10H,5-6,8-9,13H2,1H3 |
| InChIKey | KSGQTCMSWIQGJI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |